![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | rmrs_2013_houtman_r001.pdf | 2016-07-15 11:06 | 762K | |
| psw_2005_skinner(agee)001.pdf | 2016-04-07 11:45 | 901K | |
| pnw_gtr610a_methods_for_Intergrated_Modeling of Landscapes.pdf | 2015-12-15 09:08 | 2.4M | |
| forest structure_ and soil burn severity rmrs_p041_615_631.pdf | 2016-07-25 13:33 | 820K | |
| WesternForests_Effects of Thinning and Similar Stand Treatments on Fire Behavior.pdf | 2016-04-04 14:33 | 961K | |
| Thinning_Rx_firebehavior_psw_gtr193_2a_04_Omi_Martinson.pdf | 2016-04-04 14:26 | 247K | |
| Science Basis for Changing Forest Structure to Modify Wildfire Be.pdf | 2015-12-15 14:55 | 3.0M | |
| Reducing risk_fuels treatment_pnw618.pdf | 2016-04-04 15:04 | 1.8M | |
| Part B_pnw_gtr610b.pdf | 2016-07-14 10:30 | 1.3M | |
| NRFSNSciReview1_RepeatFires.pdf | 2016-07-15 11:11 | 2.3M | |
| Mount Emily_study_Ager_etal_2010.pdf | 2016-04-01 12:37 | 683K | |
![[DIR]](/icons/folder.gif) | Mark_Finney/ | 2016-10-20 12:44 | - | |
| Influence of forest_structure_on wildfire behavior.pdf | 2016-04-01 12:45 | 307K | |
| Influence_of_forest_structure_on_wildfire_behavior.pdf | 2015-12-15 14:54 | 1.0M | |
| Historical and Current Forest Landscapes_Huff et al_pnw_gtr355.pdf | 2016-07-25 14:21 | 5.4M | |
| Fuels_treatment and Firebehavior_psw_2005_skinner(agee)001.pdf | 2015-12-15 09:57 | 901K | |
| Fuels Management in forests of the inland west_rmrs_gtr231_019_068.pdf | 2016-07-25 15:31 | 1.3M | |
| Forest Fuel reduction_fire severity_pnw_2009_mitchell001.pdf | 2016-04-05 08:57 | 2.5M | |
| Effects of treatment_FM-Pollet99.pdf | 2016-04-01 14:08 | 25K | |
| EffectsThinningsimilar treatments_Graham et al pnw_gtr463.pdf | 2016-07-25 14:26 | 473K | |
| BasicPrinciples_fuels Reduction_psw_2005_skinner(agee)001.pdf | 2016-07-25 12:34 | 901K | |
|
|---|